C22H26F2N6O2S — CID 154676224
O-[2-[5-[(2,6-difluoro-1,5,6-trimethyl-8-azabicyclo[3.2.1]octan-3-yl)oxy]-1,3,4-thiadiazol-2-yl]-5-(3-methylpyrazol-1-yl)phenyl]hydroxylamine (PubChem CID 154676224) has the molecular formula C22H26F2N6O2S and a molecular weight of 476.55 g/mol. Its IUPAC name is O-[2-[5-[(2,6-difluoro-1,5,6-trimethyl-8-azabicyclo[3.2.1]octan-3-yl)oxy]-1,3,4-thiadiazol-2-yl]-5-(3-methylpyrazol-1-yl)phenyl]hydroxylamine.
| Compound Name | O-[2-[5-[(2,6-difluoro-1,5,6-trimethyl-8-azabicyclo[3.2.1]octan-3-yl)oxy]-1,3,4-thiadiazol-2-yl]-5-(3-methylpyrazol-1-yl)phenyl]hydroxylamine |
|---|---|
| PubChem CID | 154676224 |
| Molecular Formula | C22H26F2N6O2S |
| Molecular Weight | 476.55 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | O-[2-[5-[(2,6-difluoro-1,5,6-trimethyl-8-azabicyclo[3.2.1]octan-3-yl)oxy]-1,3,4-thiadiazol-2-yl]-5-(3-methylpyrazol-1-yl)phenyl]hydroxylamine |
| SMILES | Cc1ccn(-c2ccc(-c3nnc(OC4CC5(C)NC(C)(CC5(C)F)C4F)s3)c(ON)c2)n1 |
| InChI | InChI=1S/C22H26F2N6O2S/c1-12-7-8-30(28-12)13-5-6-14(15(9-13)32-25)18-26-27-19(33-18)31-16-10-22(4)21(3,24)11-20(2,29-22)17(16)23/h5-9,16-17,29H,10-11,25H2,1-4H3 |
| InChIKey | QSWOATOEJKRFEM-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 100.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.55 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|