C34H49FN6O4Si — CID 154677373
CID 154677373 (PubChem CID 154677373) has the molecular formula C34H49FN6O4Si and a molecular weight of 652.89 g/mol.
| Compound Name | CID 154677373 |
|---|---|
| PubChem CID | 154677373 |
| Molecular Formula | C34H49FN6O4Si |
| Molecular Weight | 652.89 g/mol |
| Exact Mass | 652.36 |
| IUPAC Name | — |
| SMILES | CCC(=O)N[C@@H](C(=O)NCC1CCC1)[C@@H](C)c1ccc(NC(=O)[C@@H](NC(=O)c2ccnn2CC)C2CCC(C)([Si]C)CC2)c(F)c1 |
| InChI | InChI=1S/C34H49FN6O4Si/c1-6-28(42)39-29(32(44)36-20-22-9-8-10-22)21(3)24-11-12-26(25(35)19-24)38-33(45)30(23-13-16-34(4,46-5)17-14-23)40-31(43)27-15-18-37-41(27)7-2/h11-12,15,18-19,21-23,29-30H,6-10,13-14,16-17,20H2,1-5H3,(H,36,44)(H,38,45)(H,39,42)(H,40,43)/t21-,23?,29+,30-,34?/m0/s1 |
| InChIKey | YEQWNXHRDNWNNI-NJSWHUDQSA-N |
| XLogP | 4.81 |
| TPSA | 134.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.89 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|