C18H27NO — CID 15467778
1-[2-(cyclohexen-1-yl)ethyl]-3,3-dimethyl-4,5,6,7-tetrahydroindol-2-one (PubChem CID 15467778) has the molecular formula C18H27NO and a molecular weight of 273.42 g/mol. Its IUPAC name is 1-[2-(cyclohexen-1-yl)ethyl]-3,3-dimethyl-4,5,6,7-tetrahydroindol-2-one.
| Compound Name | 1-[2-(cyclohexen-1-yl)ethyl]-3,3-dimethyl-4,5,6,7-tetrahydroindol-2-one |
|---|---|
| PubChem CID | 15467778 |
| Molecular Formula | C18H27NO |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | 1-[2-(cyclohexen-1-yl)ethyl]-3,3-dimethyl-4,5,6,7-tetrahydroindol-2-one |
| SMILES | CC1(C)C(=O)N(CCC2=CCCCC2)C2=C1CCCC2 |
| InChI | InChI=1S/C18H27NO/c1-18(2)15-10-6-7-11-16(15)19(17(18)20)13-12-14-8-4-3-5-9-14/h8H,3-7,9-13H2,1-2H3 |
| InChIKey | SDYUTUDAKSHTMP-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|