C14H26N2O — CID 154677975
7-ethoxy-4-ethyl-1,2,3,5,6,7,8,9,10,10a-decahydrocycloocta[d]pyridazine (PubChem CID 154677975) has the molecular formula C14H26N2O and a molecular weight of 238.37 g/mol. Its IUPAC name is 7-ethoxy-4-ethyl-1,2,3,5,6,7,8,9,10,10a-decahydrocycloocta[d]pyridazine.
| Compound Name | 7-ethoxy-4-ethyl-1,2,3,5,6,7,8,9,10,10a-decahydrocycloocta[d]pyridazine |
|---|---|
| PubChem CID | 154677975 |
| Molecular Formula | C14H26N2O |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.20 |
| IUPAC Name | 7-ethoxy-4-ethyl-1,2,3,5,6,7,8,9,10,10a-decahydrocycloocta[d]pyridazine |
| SMILES | CCOC1CCCC2CNNC(CC)=C2CC1 |
| InChI | InChI=1S/C14H26N2O/c1-3-14-13-9-8-12(17-4-2)7-5-6-11(13)10-15-16-14/h11-12,15-16H,3-10H2,1-2H3 |
| InChIKey | JUSYWXZZEXTDJW-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |