About acetylene;3-(4-fluorophenyl)-7-hydroxy-2,3-dihydrochromen-4-one
acetylene;3-(4-fluorophenyl)-7-hydroxy-2,3-dihydrochromen-4-one (PubChem CID 154678052) has the molecular formula C17H13FO3
and a molecular weight of 284.29 g/mol. Its IUPAC name is acetylene;3-(4-fluorophenyl)-7-hydroxy-2,3-dihydrochromen-4-one.
Molecular Properties
| Compound Name | acetylene;3-(4-fluorophenyl)-7-hydroxy-2,3-dihydrochromen-4-one |
| PubChem CID | 154678052 |
| Molecular Formula | C17H13FO3 |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | acetylene;3-(4-fluorophenyl)-7-hydroxy-2,3-dihydrochromen-4-one |
| SMILES | C#C.O=C1c2ccc(O)cc2OCC1c1ccc(F)cc1 |
| InChI | InChI=1S/C15H11FO3.C2H2/c16-10-3-1-9(2-4-10)13-8-19-14-7-11(17)5-6-12(14)15(13)18;1-2/h1-7,13,17H,8H2;1-2H |
| InChIKey | XUXQJUSEDGGXRO-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;3-(4-fluorophenyl)-7-hydroxy-2,3-dihydrochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;3-(4-fluorophenyl)-7-hydroxy-2,3-dihydrochromen-4-one?
The IUPAC name of acetylene;3-(4-fluorophenyl)-7-hydroxy-2,3-dihydrochromen-4-one (CID 154678052) is acetylene;3-(4-fluorophenyl)-7-hydroxy-2,3-dihydrochromen-4-one.
What is the SMILES notation for acetylene;3-(4-fluorophenyl)-7-hydroxy-2,3-dihydrochromen-4-one?
The canonical SMILES for acetylene;3-(4-fluorophenyl)-7-hydroxy-2,3-dihydrochromen-4-one is C#C.O=C1c2ccc(O)cc2OCC1c1ccc(F)cc1.
What is the InChIKey of acetylene;3-(4-fluorophenyl)-7-hydroxy-2,3-dihydrochromen-4-one?
The InChIKey is XUXQJUSEDGGXRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11FO3.C2H2/c16-10-3-1-9(2-4-10)13-8-19-14-7-11(17)5-6-12(14)15(13)18;1-2/h1-7,13,17H,8H2;1-2H.
What are the key properties of acetylene;3-(4-fluorophenyl)-7-hydroxy-2,3-dihydrochromen-4-one?
acetylene;3-(4-fluorophenyl)-7-hydroxy-2,3-dihydrochromen-4-one has a molecular weight of 284.29 g/mol, XLogP of 3.14, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;3-(4-fluorophenyl)-7-hydroxy-2,3-dihydrochromen-4-one is sourced from PubChem (CID 154678052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).