C24H32N6O4 — CID 154678213
tert-butyl N-[6-[1-[(Z)-2-cyano-1-cyclopentylethenyl]pyrazol-4-yl]-5-(2,2-dimethoxyethyl)pyrimidin-4-yl]carbamate (PubChem CID 154678213) has the molecular formula C24H32N6O4 and a molecular weight of 468.56 g/mol. Its IUPAC name is tert-butyl N-[6-[1-[(Z)-2-cyano-1-cyclopentylethenyl]pyrazol-4-yl]-5-(2,2-dimethoxyethyl)pyrimidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[6-[1-[(Z)-2-cyano-1-cyclopentylethenyl]pyrazol-4-yl]-5-(2,2-dimethoxyethyl)pyrimidin-4-yl]carbamate |
|---|---|
| PubChem CID | 154678213 |
| Molecular Formula | C24H32N6O4 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | tert-butyl N-[6-[1-[(Z)-2-cyano-1-cyclopentylethenyl]pyrazol-4-yl]-5-(2,2-dimethoxyethyl)pyrimidin-4-yl]carbamate |
| SMILES | COC(Cc1c(NC(=O)OC(C)(C)C)ncnc1-c1cnn(/C(=C\C#N)C2CCCC2)c1)OC |
| InChI | InChI=1S/C24H32N6O4/c1-24(2,3)34-23(31)29-22-18(12-20(32-4)33-5)21(26-15-27-22)17-13-28-30(14-17)19(10-11-25)16-8-6-7-9-16/h10,13-16,20H,6-9,12H2,1-5H3,(H,26,27,29,31)/b19-10- |
| InChIKey | DINJGOSPLPJIDX-GRSHGNNSSA-N |
| XLogP | 4.40 |
| TPSA | 124.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|