C34H33F2N5O6 — CID 154678258
(1R,3S)-3-[2-[3-[[(2S,4R,5R)-5-(2-anilino-6-methoxypurin-9-yl)-4-hydroxyoxolan-2-yl]methoxy]phenyl]ethyl]-2,2-difluoro-1H-indene-1,3-diol (PubChem CID 154678258) has the molecular formula C34H33F2N5O6 and a molecular weight of 645.66 g/mol. Its IUPAC name is (1R,3S)-3-[2-[3-[[(2S,4R,5R)-5-(2-anilino-6-methoxypurin-9-yl)-4-hydroxyoxolan-2-yl]methoxy]phenyl]ethyl]-2,2-difluoro-1H-indene-1,3-diol.
| Compound Name | (1R,3S)-3-[2-[3-[[(2S,4R,5R)-5-(2-anilino-6-methoxypurin-9-yl)-4-hydroxyoxolan-2-yl]methoxy]phenyl]ethyl]-2,2-difluoro-1H-indene-1,3-diol |
|---|---|
| PubChem CID | 154678258 |
| Molecular Formula | C34H33F2N5O6 |
| Molecular Weight | 645.66 g/mol |
| Exact Mass | 645.24 |
| IUPAC Name | (1R,3S)-3-[2-[3-[[(2S,4R,5R)-5-(2-anilino-6-methoxypurin-9-yl)-4-hydroxyoxolan-2-yl]methoxy]phenyl]ethyl]-2,2-difluoro-1H-indene-1,3-diol |
| SMILES | COc1nc(Nc2ccccc2)nc2c1ncn2[C@@H]1O[C@H](COc2cccc(CC[C@]3(O)c4ccccc4[C@@H](O)C3(F)F)c2)C[C@H]1O |
| InChI | InChI=1S/C34H33F2N5O6/c1-45-30-27-29(39-32(40-30)38-21-9-3-2-4-10-21)41(19-37-27)31-26(42)17-23(47-31)18-46-22-11-7-8-20(16-22)14-15-33(44)25-13-6-5-12-24(25)28(43)34(33,35)36/h2-13,16,19,23,26,28,31,42-44H,14-15,17-18H2,1H3,(H,38,39,40)/t23-,26+,28+,31+,33-/m0/s1 |
| InChIKey | SWVOKFRQTBFJOP-DVOHPEILSA-N |
| XLogP | 4.81 |
| TPSA | 144.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.66 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |