C27H24F3N5O7 — CID 154678296
2-[3-[3-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-5-(trifluoromethyl)phenyl]propanoyl]benzoic acid (PubChem CID 154678296) has the molecular formula C27H24F3N5O7 and a molecular weight of 587.51 g/mol. Its IUPAC name is 2-[3-[3-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-5-(trifluoromethyl)phenyl]propanoyl]benzoic acid.
| Compound Name | 2-[3-[3-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-5-(trifluoromethyl)phenyl]propanoyl]benzoic acid |
|---|---|
| PubChem CID | 154678296 |
| Molecular Formula | C27H24F3N5O7 |
| Molecular Weight | 587.51 g/mol |
| Exact Mass | 587.16 |
| IUPAC Name | 2-[3-[3-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-5-(trifluoromethyl)phenyl]propanoyl]benzoic acid |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COc2cc(CCC(=O)c3ccccc3C(=O)O)cc(C(F)(F)F)c2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C27H24F3N5O7/c28-27(29,30)14-7-13(5-6-18(36)16-3-1-2-4-17(16)26(39)40)8-15(9-14)41-10-19-21(37)22(38)25(42-19)35-12-34-20-23(31)32-11-33-24(20)35/h1-4,7-9,11-12,19,21-22,25,37-38H,5-6,10H2,(H,39,40)(H2,31,32,33)/t19-,21-,22-,25-/m1/s1 |
| InChIKey | MARWYAZYXCDINR-PTGPVQHPSA-N |
| XLogP | 2.64 |
| TPSA | 182.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.51 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |