C14H22O6Si — CID 15467938
dimethyl (1R,3S,5S)-3-methyl-1-trimethylsilyloxy-2-oxabicyclo[3.2.0]hept-6-ene-6,7-dicarboxylate (PubChem CID 15467938) has the molecular formula C14H22O6Si and a molecular weight of 314.41 g/mol. Its IUPAC name is dimethyl (1R,3S,5S)-3-methyl-1-trimethylsilyloxy-2-oxabicyclo[3.2.0]hept-6-ene-6,7-dicarboxylate.
| Compound Name | dimethyl (1R,3S,5S)-3-methyl-1-trimethylsilyloxy-2-oxabicyclo[3.2.0]hept-6-ene-6,7-dicarboxylate |
|---|---|
| PubChem CID | 15467938 |
| Molecular Formula | C14H22O6Si |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | dimethyl (1R,3S,5S)-3-methyl-1-trimethylsilyloxy-2-oxabicyclo[3.2.0]hept-6-ene-6,7-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@@]2(O[Si](C)(C)C)O[C@@H](C)C[C@@H]12 |
| InChI | InChI=1S/C14H22O6Si/c1-8-7-9-10(12(15)17-2)11(13(16)18-3)14(9,19-8)20-21(4,5)6/h8-9H,7H2,1-6H3/t8-,9-,14+/m0/s1 |
| InChIKey | RESXHPZSXCUKBG-UINNMSKDSA-N |
| XLogP | 1.62 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|