C25H30N5O2+ — CID 154679411
(4-isoquinolin-2-ium-2-ylpiperidin-1-yl)-[2-(1,5-oxazocan-5-yl)pyrimidin-5-yl]methanone (PubChem CID 154679411) has the molecular formula C25H30N5O2+ and a molecular weight of 432.55 g/mol. Its IUPAC name is (4-isoquinolin-2-ium-2-ylpiperidin-1-yl)-[2-(1,5-oxazocan-5-yl)pyrimidin-5-yl]methanone.
| Compound Name | (4-isoquinolin-2-ium-2-ylpiperidin-1-yl)-[2-(1,5-oxazocan-5-yl)pyrimidin-5-yl]methanone |
|---|---|
| PubChem CID | 154679411 |
| Molecular Formula | C25H30N5O2+ |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | (4-isoquinolin-2-ium-2-ylpiperidin-1-yl)-[2-(1,5-oxazocan-5-yl)pyrimidin-5-yl]methanone |
| SMILES | O=C(c1cnc(N2CCCOCCC2)nc1)N1CCC([n+]2ccc3ccccc3c2)CC1 |
| InChI | InChI=1S/C25H30N5O2/c31-24(22-17-26-25(27-18-22)29-10-3-15-32-16-4-11-29)28-13-8-23(9-14-28)30-12-7-20-5-1-2-6-21(20)19-30/h1-2,5-7,12,17-19,23H,3-4,8-11,13-16H2/q+1 |
| InChIKey | VAJWJVVLKJIFAF-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 62.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|