C24H22F2N4O5 — CID 154679449
[2-fluoro-4-[5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazol-3-yl]phenyl]-(1,3-oxazinan-3-yl)methanone (PubChem CID 154679449) has the molecular formula C24H22F2N4O5 and a molecular weight of 484.46 g/mol. Its IUPAC name is [2-fluoro-4-[5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazol-3-yl]phenyl]-(1,3-oxazinan-3-yl)methanone.
| Compound Name | [2-fluoro-4-[5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazol-3-yl]phenyl]-(1,3-oxazinan-3-yl)methanone |
|---|---|
| PubChem CID | 154679449 |
| Molecular Formula | C24H22F2N4O5 |
| Molecular Weight | 484.46 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | [2-fluoro-4-[5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazol-3-yl]phenyl]-(1,3-oxazinan-3-yl)methanone |
| SMILES | COCCOc1cc2[nH]nc(-c3cc(-c4ccc(C(=O)N5CCCOC5)c(F)c4)no3)c2cc1F |
| InChI | InChI=1S/C24H22F2N4O5/c1-32-7-8-34-21-12-20-16(10-18(21)26)23(28-27-20)22-11-19(29-35-22)14-3-4-15(17(25)9-14)24(31)30-5-2-6-33-13-30/h3-4,9-12H,2,5-8,13H2,1H3,(H,27,28) |
| InChIKey | ILYHTTUBJKMREI-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 102.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.46 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|