About methyl 4-[5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazol-3-yl]benzoate
methyl 4-[5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazol-3-yl]benzoate (PubChem CID 154679489) has the molecular formula C21H18FN3O5
and a molecular weight of 411.39 g/mol. Its IUPAC name is methyl 4-[5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazol-3-yl]benzoate.
Molecular Properties
| Compound Name | methyl 4-[5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazol-3-yl]benzoate |
| PubChem CID | 154679489 |
| Molecular Formula | C21H18FN3O5 |
| Molecular Weight | 411.39 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | methyl 4-[5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazol-3-yl]benzoate |
| SMILES | COCCOc1cc2[nH]nc(-c3cc(-c4ccc(C(=O)OC)cc4)no3)c2cc1F |
| InChI | InChI=1S/C21H18FN3O5/c1-27-7-8-29-18-11-17-14(9-15(18)22)20(24-23-17)19-10-16(25-30-19)12-3-5-13(6-4-12)21(26)28-2/h3-6,9-11H,7-8H2,1-2H3,(H,23,24) |
| InChIKey | ZJZXMERSOHWKNQ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 99.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.39 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-[5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazol-3-yl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazol-3-yl]benzoate?
The IUPAC name of methyl 4-[5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazol-3-yl]benzoate (CID 154679489) is methyl 4-[5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazol-3-yl]benzoate.
What is the SMILES notation for methyl 4-[5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazol-3-yl]benzoate?
The canonical SMILES for methyl 4-[5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazol-3-yl]benzoate is COCCOc1cc2[nH]nc(-c3cc(-c4ccc(C(=O)OC)cc4)no3)c2cc1F.
What is the InChIKey of methyl 4-[5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazol-3-yl]benzoate?
The InChIKey is ZJZXMERSOHWKNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18FN3O5/c1-27-7-8-29-18-11-17-14(9-15(18)22)20(24-23-17)19-10-16(25-30-19)12-3-5-13(6-4-12)21(26)28-2/h3-6,9-11H,7-8H2,1-2H3,(H,23,24).
What are the key properties of methyl 4-[5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazol-3-yl]benzoate?
methyl 4-[5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazol-3-yl]benzoate has a molecular weight of 411.39 g/mol, XLogP of 3.84, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazol-3-yl]benzoate is sourced from PubChem (CID 154679489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).