C27H27FN4O5 — CID 154679490
[(3aR,7aS)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-2-yl]-[4-[5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazol-3-yl]phenyl]methanone (PubChem CID 154679490) has the molecular formula C27H27FN4O5 and a molecular weight of 506.53 g/mol. Its IUPAC name is [(3aR,7aS)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-2-yl]-[4-[5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazol-3-yl]phenyl]methanone.
| Compound Name | [(3aR,7aS)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-2-yl]-[4-[5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazol-3-yl]phenyl]methanone |
|---|---|
| PubChem CID | 154679490 |
| Molecular Formula | C27H27FN4O5 |
| Molecular Weight | 506.53 g/mol |
| Exact Mass | 506.20 |
| IUPAC Name | [(3aR,7aS)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-2-yl]-[4-[5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazol-3-yl]phenyl]methanone |
| SMILES | COCCOc1cc2[nH]nc(-c3cc(-c4ccc(C(=O)N5C[C@H]6CCOC[C@H]6C5)cc4)no3)c2cc1F |
| InChI | InChI=1S/C27H27FN4O5/c1-34-8-9-36-24-12-23-20(10-21(24)28)26(30-29-23)25-11-22(31-37-25)16-2-4-17(5-3-16)27(33)32-13-18-6-7-35-15-19(18)14-32/h2-5,10-12,18-19H,6-9,13-15H2,1H3,(H,29,30)/t18-,19-/m1/s1 |
| InChIKey | RASPBDNVTCZLND-RTBURBONSA-N |
| XLogP | 4.16 |
| TPSA | 102.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.53 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|