C26H26FN5O4 — CID 154679520
[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[4-[5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazol-3-yl]phenyl]methanone (PubChem CID 154679520) has the molecular formula C26H26FN5O4 and a molecular weight of 491.52 g/mol. Its IUPAC name is [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[4-[5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazol-3-yl]phenyl]methanone.
| Compound Name | [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[4-[5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazol-3-yl]phenyl]methanone |
|---|---|
| PubChem CID | 154679520 |
| Molecular Formula | C26H26FN5O4 |
| Molecular Weight | 491.52 g/mol |
| Exact Mass | 491.20 |
| IUPAC Name | [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[4-[5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazol-3-yl]phenyl]methanone |
| SMILES | COCCOc1cc2[nH]nc(-c3cc(-c4ccc(C(=O)N5C[C@H]6CNC[C@H]6C5)cc4)no3)c2cc1F |
| InChI | InChI=1S/C26H26FN5O4/c1-34-6-7-35-23-10-22-19(8-20(23)27)25(30-29-22)24-9-21(31-36-24)15-2-4-16(5-3-15)26(33)32-13-17-11-28-12-18(17)14-32/h2-5,8-10,17-18,28H,6-7,11-14H2,1H3,(H,29,30)/t17-,18+ |
| InChIKey | QVXXXNGOVSUYEA-HDICACEKSA-N |
| XLogP | 3.34 |
| TPSA | 105.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.52 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|