C26H29FN4O3 — CID 154679521
3-[4-(3,3-dimethylpiperidin-4-yl)phenyl]-5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazole (PubChem CID 154679521) has the molecular formula C26H29FN4O3 and a molecular weight of 464.54 g/mol. Its IUPAC name is 3-[4-(3,3-dimethylpiperidin-4-yl)phenyl]-5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazole.
| Compound Name | 3-[4-(3,3-dimethylpiperidin-4-yl)phenyl]-5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazole |
|---|---|
| PubChem CID | 154679521 |
| Molecular Formula | C26H29FN4O3 |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | 3-[4-(3,3-dimethylpiperidin-4-yl)phenyl]-5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazole |
| SMILES | COCCOc1cc2[nH]nc(-c3cc(-c4ccc(C5CCNCC5(C)C)cc4)no3)c2cc1F |
| InChI | InChI=1S/C26H29FN4O3/c1-26(2)15-28-9-8-19(26)16-4-6-17(7-5-16)21-13-24(34-31-21)25-18-12-20(27)23(33-11-10-32-3)14-22(18)29-30-25/h4-7,12-14,19,28H,8-11,15H2,1-3H3,(H,29,30) |
| InChIKey | KPBFCIHLADNSAQ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 85.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|