C26H28FN5O3 — CID 154679523
3-[4-[(3aS,6aS)-1-methyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]phenyl]-5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazole (PubChem CID 154679523) has the molecular formula C26H28FN5O3 and a molecular weight of 477.54 g/mol. Its IUPAC name is 3-[4-[(3aS,6aS)-1-methyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]phenyl]-5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazole.
| Compound Name | 3-[4-[(3aS,6aS)-1-methyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]phenyl]-5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazole |
|---|---|
| PubChem CID | 154679523 |
| Molecular Formula | C26H28FN5O3 |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | 3-[4-[(3aS,6aS)-1-methyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]phenyl]-5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazole |
| SMILES | COCCOc1cc2[nH]nc(-c3cc(-c4ccc(N5CC[C@H]6[C@@H]5CCN6C)cc4)no3)c2cc1F |
| InChI | InChI=1S/C26H28FN5O3/c1-31-9-7-23-22(31)8-10-32(23)17-5-3-16(4-6-17)20-14-25(35-30-20)26-18-13-19(27)24(34-12-11-33-2)15-21(18)28-29-26/h3-6,13-15,22-23H,7-12H2,1-2H3,(H,28,29)/t22-,23-/m0/s1 |
| InChIKey | RLQILMWMKWTTPC-GOTSBHOMSA-N |
| XLogP | 4.33 |
| TPSA | 79.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|