C27H30FN5O3 — CID 154679549
3-[4-[(3aR,7aR)-4-methyl-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridin-1-yl]phenyl]-5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazole (PubChem CID 154679549) has the molecular formula C27H30FN5O3 and a molecular weight of 491.57 g/mol. Its IUPAC name is 3-[4-[(3aR,7aR)-4-methyl-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridin-1-yl]phenyl]-5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazole.
| Compound Name | 3-[4-[(3aR,7aR)-4-methyl-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridin-1-yl]phenyl]-5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazole |
|---|---|
| PubChem CID | 154679549 |
| Molecular Formula | C27H30FN5O3 |
| Molecular Weight | 491.57 g/mol |
| Exact Mass | 491.23 |
| IUPAC Name | 3-[4-[(3aR,7aR)-4-methyl-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridin-1-yl]phenyl]-5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazole |
| SMILES | COCCOc1cc2[nH]nc(-c3cc(-c4ccc(N5CC[C@@H]6[C@H]5CCCN6C)cc4)no3)c2cc1F |
| InChI | InChI=1S/C27H30FN5O3/c1-32-10-3-4-24-23(32)9-11-33(24)18-7-5-17(6-8-18)21-15-26(36-31-21)27-19-14-20(28)25(35-13-12-34-2)16-22(19)29-30-27/h5-8,14-16,23-24H,3-4,9-13H2,1-2H3,(H,29,30)/t23-,24-/m1/s1 |
| InChIKey | RYRBMDDBTSJSFB-DNQXCXABSA-N |
| XLogP | 4.72 |
| TPSA | 79.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.57 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|