About 4-[5-[6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazol-3-yl]benzoic acid
4-[5-[6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazol-3-yl]benzoic acid (PubChem CID 154679588) has the molecular formula C20H17N3O5
and a molecular weight of 379.37 g/mol. Its IUPAC name is 4-[5-[6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazol-3-yl]benzoic acid.
Molecular Properties
| Compound Name | 4-[5-[6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazol-3-yl]benzoic acid |
| PubChem CID | 154679588 |
| Molecular Formula | C20H17N3O5 |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | 4-[5-[6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazol-3-yl]benzoic acid |
| SMILES | COCCOc1ccc2c(-c3cc(-c4ccc(C(=O)O)cc4)no3)n[nH]c2c1 |
| InChI | InChI=1S/C20H17N3O5/c1-26-8-9-27-14-6-7-15-17(10-14)21-22-19(15)18-11-16(23-28-18)12-2-4-13(5-3-12)20(24)25/h2-7,10-11H,8-9H2,1H3,(H,21,22)(H,24,25) |
| InChIKey | GDOUZWDLIQYQMK-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 110.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[5-[6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazol-3-yl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-[6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazol-3-yl]benzoic acid?
The IUPAC name of 4-[5-[6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazol-3-yl]benzoic acid (CID 154679588) is 4-[5-[6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazol-3-yl]benzoic acid.
What is the SMILES notation for 4-[5-[6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazol-3-yl]benzoic acid?
The canonical SMILES for 4-[5-[6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazol-3-yl]benzoic acid is COCCOc1ccc2c(-c3cc(-c4ccc(C(=O)O)cc4)no3)n[nH]c2c1.
What is the InChIKey of 4-[5-[6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazol-3-yl]benzoic acid?
The InChIKey is GDOUZWDLIQYQMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17N3O5/c1-26-8-9-27-14-6-7-15-17(10-14)21-22-19(15)18-11-16(23-28-18)12-2-4-13(5-3-12)20(24)25/h2-7,10-11H,8-9H2,1H3,(H,21,22)(H,24,25).
What are the key properties of 4-[5-[6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazol-3-yl]benzoic acid?
4-[5-[6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazol-3-yl]benzoic acid has a molecular weight of 379.37 g/mol, XLogP of 3.61, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-[6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazol-3-yl]benzoic acid is sourced from PubChem (CID 154679588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).