C21H20FN5O4 — CID 154679592
6-[5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazol-3-yl]-N,N-dimethylpyridine-3-carboxamide (PubChem CID 154679592) has the molecular formula C21H20FN5O4 and a molecular weight of 425.42 g/mol. Its IUPAC name is 6-[5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazol-3-yl]-N,N-dimethylpyridine-3-carboxamide.
| Compound Name | 6-[5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazol-3-yl]-N,N-dimethylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 154679592 |
| Molecular Formula | C21H20FN5O4 |
| Molecular Weight | 425.42 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 6-[5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazol-3-yl]-N,N-dimethylpyridine-3-carboxamide |
| SMILES | COCCOc1cc2[nH]nc(-c3cc(-c4ccc(C(=O)N(C)C)cn4)no3)c2cc1F |
| InChI | InChI=1S/C21H20FN5O4/c1-27(2)21(28)12-4-5-15(23-11-12)17-10-19(31-26-17)20-13-8-14(22)18(30-7-6-29-3)9-16(13)24-25-20/h4-5,8-11H,6-7H2,1-3H3,(H,24,25) |
| InChIKey | FRQGIBCXCZEZTE-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 106.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.42 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|