About 3-(6-ethoxy-3-pyridinyl)-5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazole
3-(6-ethoxy-3-pyridinyl)-5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazole (PubChem CID 154679594) has the molecular formula C20H19FN4O4
and a molecular weight of 398.39 g/mol. Its IUPAC name is 3-(6-ethoxy-3-pyridinyl)-5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazole.
Molecular Properties
| Compound Name | 3-(6-ethoxy-3-pyridinyl)-5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazole |
| PubChem CID | 154679594 |
| Molecular Formula | C20H19FN4O4 |
| Molecular Weight | 398.39 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 3-(6-ethoxy-3-pyridinyl)-5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazole |
| SMILES | CCOc1ccc(-c2cc(-c3n[nH]c4cc(OCCOC)c(F)cc34)on2)cn1 |
| InChI | InChI=1S/C20H19FN4O4/c1-3-27-19-5-4-12(11-22-19)15-9-18(29-25-15)20-13-8-14(21)17(28-7-6-26-2)10-16(13)23-24-20/h4-5,8-11H,3,6-7H2,1-2H3,(H,23,24) |
| InChIKey | KNPFAIIWWMBHDV-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 95.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.39 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(6-ethoxy-3-pyridinyl)-5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(6-ethoxy-3-pyridinyl)-5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazole?
The IUPAC name of 3-(6-ethoxy-3-pyridinyl)-5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazole (CID 154679594) is 3-(6-ethoxy-3-pyridinyl)-5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazole.
What is the SMILES notation for 3-(6-ethoxy-3-pyridinyl)-5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazole?
The canonical SMILES for 3-(6-ethoxy-3-pyridinyl)-5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazole is CCOc1ccc(-c2cc(-c3n[nH]c4cc(OCCOC)c(F)cc34)on2)cn1.
What is the InChIKey of 3-(6-ethoxy-3-pyridinyl)-5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazole?
The InChIKey is KNPFAIIWWMBHDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19FN4O4/c1-3-27-19-5-4-12(11-22-19)15-9-18(29-25-15)20-13-8-14(21)17(28-7-6-26-2)10-16(13)23-24-20/h4-5,8-11H,3,6-7H2,1-2H3,(H,23,24).
What are the key properties of 3-(6-ethoxy-3-pyridinyl)-5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazole?
3-(6-ethoxy-3-pyridinyl)-5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazole has a molecular weight of 398.39 g/mol, XLogP of 3.84, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(6-ethoxy-3-pyridinyl)-5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazole is sourced from PubChem (CID 154679594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).