C20H17FN3O5- — CID 154679712
4-[5-[2-amino-5-fluoro-4-(2-methoxyethoxy)benzenecarboximidoyl]-1,2-oxazol-3-yl]benzoate (PubChem CID 154679712) has the molecular formula C20H17FN3O5- and a molecular weight of 398.37 g/mol. Its IUPAC name is 4-[5-[2-amino-5-fluoro-4-(2-methoxyethoxy)benzenecarboximidoyl]-1,2-oxazol-3-yl]benzoate.
| Compound Name | 4-[5-[2-amino-5-fluoro-4-(2-methoxyethoxy)benzenecarboximidoyl]-1,2-oxazol-3-yl]benzoate |
|---|---|
| PubChem CID | 154679712 |
| Molecular Formula | C20H17FN3O5- |
| Molecular Weight | 398.37 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 4-[5-[2-amino-5-fluoro-4-(2-methoxyethoxy)benzenecarboximidoyl]-1,2-oxazol-3-yl]benzoate |
| SMILES | [H]/N=C(\c1cc(-c2ccc(C(=O)[O-])cc2)no1)c1cc(F)c(OCCOC)cc1N |
| InChI | InChI=1S/C20H18FN3O5/c1-27-6-7-28-17-9-15(22)13(8-14(17)21)19(23)18-10-16(24-29-18)11-2-4-12(5-3-11)20(25)26/h2-5,8-10,23H,6-7,22H2,1H3,(H,25,26)/p-1/b23-19- |
| InChIKey | UOAXFFNKOSMCFX-NMWGTECJSA-M |
| XLogP | 1.87 |
| TPSA | 134.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.37 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|