C24H24F3NO4 — CID 154680003
9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-(3,3,3-trifluoro-2-oxopropanoyl)-3-azaspiro[5.5]undecane-8,10-dione (PubChem CID 154680003) has the molecular formula C24H24F3NO4 and a molecular weight of 447.45 g/mol. Its IUPAC name is 9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-(3,3,3-trifluoro-2-oxopropanoyl)-3-azaspiro[5.5]undecane-8,10-dione.
| Compound Name | 9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-(3,3,3-trifluoro-2-oxopropanoyl)-3-azaspiro[5.5]undecane-8,10-dione |
|---|---|
| PubChem CID | 154680003 |
| Molecular Formula | C24H24F3NO4 |
| Molecular Weight | 447.45 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | 9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-(3,3,3-trifluoro-2-oxopropanoyl)-3-azaspiro[5.5]undecane-8,10-dione |
| SMILES | CC#Cc1cc(C)c(C2C(=O)CC3(CCN(C(=O)C(=O)C(F)(F)F)CC3)CC2=O)c(C)c1 |
| InChI | InChI=1S/C24H24F3NO4/c1-4-5-16-10-14(2)19(15(3)11-16)20-17(29)12-23(13-18(20)30)6-8-28(9-7-23)22(32)21(31)24(25,26)27/h10-11,20H,6-9,12-13H2,1-3H3 |
| InChIKey | DAWKWSGRZXRRLV-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.45 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|