About ethane;3-methyl-5,6-dihydro-1H-indole
ethane;3-methyl-5,6-dihydro-1H-indole (PubChem CID 154680136) has the molecular formula C15H29N
and a molecular weight of 223.40 g/mol. Its IUPAC name is ethane;3-methyl-5,6-dihydro-1H-indole.
Molecular Properties
| Compound Name | ethane;3-methyl-5,6-dihydro-1H-indole |
| PubChem CID | 154680136 |
| Molecular Formula | C15H29N |
| Molecular Weight | 223.40 g/mol |
| Exact Mass | 223.23 |
| IUPAC Name | ethane;3-methyl-5,6-dihydro-1H-indole |
| SMILES | CC.CC.CC.Cc1c[nH]c2c1=CCCC=2 |
| InChI | InChI=1S/C9H11N.3C2H6/c1-7-6-10-9-5-3-2-4-8(7)9;3*1-2/h4-6,10H,2-3H2,1H3;3*1-2H3 |
| InChIKey | QXTRBDULGNNXKZ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.40 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze ethane;3-methyl-5,6-dihydro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-methyl-5,6-dihydro-1H-indole?
The IUPAC name of ethane;3-methyl-5,6-dihydro-1H-indole (CID 154680136) is ethane;3-methyl-5,6-dihydro-1H-indole.
What is the SMILES notation for ethane;3-methyl-5,6-dihydro-1H-indole?
The canonical SMILES for ethane;3-methyl-5,6-dihydro-1H-indole is CC.CC.CC.Cc1c[nH]c2c1=CCCC=2.
What is the InChIKey of ethane;3-methyl-5,6-dihydro-1H-indole?
The InChIKey is QXTRBDULGNNXKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N.3C2H6/c1-7-6-10-9-5-3-2-4-8(7)9;3*1-2/h4-6,10H,2-3H2,1H3;3*1-2H3.
What are the key properties of ethane;3-methyl-5,6-dihydro-1H-indole?
ethane;3-methyl-5,6-dihydro-1H-indole has a molecular weight of 223.40 g/mol, XLogP of 3.76, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-methyl-5,6-dihydro-1H-indole is sourced from PubChem (CID 154680136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).