About methyl 2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-hydroxypropanoate
methyl 2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-hydroxypropanoate (PubChem CID 154680439) has the molecular formula C8H15NO5S
and a molecular weight of 237.28 g/mol. Its IUPAC name is methyl 2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-hydroxypropanoate.
Molecular Properties
| Compound Name | methyl 2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-hydroxypropanoate |
| PubChem CID | 154680439 |
| Molecular Formula | C8H15NO5S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | methyl 2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-hydroxypropanoate |
| SMILES | COC(=O)C(CO)N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C8H15NO5S/c1-14-8(11)7(6-10)9-2-4-15(12,13)5-3-9/h7,10H,2-6H2,1H3 |
| InChIKey | UXROAVOLSCYVON-UHFFFAOYSA-N |
| XLogP | -1.75 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-hydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-hydroxypropanoate?
The IUPAC name of methyl 2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-hydroxypropanoate (CID 154680439) is methyl 2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-hydroxypropanoate.
What is the SMILES notation for methyl 2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-hydroxypropanoate?
The canonical SMILES for methyl 2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-hydroxypropanoate is COC(=O)C(CO)N1CCS(=O)(=O)CC1.
What is the InChIKey of methyl 2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-hydroxypropanoate?
The InChIKey is UXROAVOLSCYVON-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO5S/c1-14-8(11)7(6-10)9-2-4-15(12,13)5-3-9/h7,10H,2-6H2,1H3.
What are the key properties of methyl 2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-hydroxypropanoate?
methyl 2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-hydroxypropanoate has a molecular weight of 237.28 g/mol, XLogP of -1.75, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-hydroxypropanoate is sourced from PubChem (CID 154680439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).