C15H31NO7S — CID 154680463
(2R,3R)-2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]butan-1-ol (PubChem CID 154680463) has the molecular formula C15H31NO7S and a molecular weight of 369.48 g/mol. Its IUPAC name is (2R,3R)-2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]butan-1-ol.
| Compound Name | (2R,3R)-2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]butan-1-ol |
|---|---|
| PubChem CID | 154680463 |
| Molecular Formula | C15H31NO7S |
| Molecular Weight | 369.48 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | (2R,3R)-2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]butan-1-ol |
| SMILES | COCCOCCOCCO[C@H](C)[C@@H](CO)N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C15H31NO7S/c1-14(23-10-9-22-8-7-21-6-5-20-2)15(13-17)16-3-11-24(18,19)12-4-16/h14-15,17H,3-13H2,1-2H3/t14-,15-/m1/s1 |
| InChIKey | UVKAOCXBCCZWOU-HUUCEWRRSA-N |
| XLogP | -0.84 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.48 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|