C8H16FNO3S — CID 154680480
(2R,3S)-2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-fluorobutan-1-ol (PubChem CID 154680480) has the molecular formula C8H16FNO3S and a molecular weight of 225.28 g/mol. Its IUPAC name is (2R,3S)-2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-fluorobutan-1-ol.
| Compound Name | (2R,3S)-2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-fluorobutan-1-ol |
|---|---|
| PubChem CID | 154680480 |
| Molecular Formula | C8H16FNO3S |
| Molecular Weight | 225.28 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | (2R,3S)-2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-fluorobutan-1-ol |
| SMILES | C[C@H](F)[C@@H](CO)N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C8H16FNO3S/c1-7(9)8(6-11)10-2-4-14(12,13)5-3-10/h7-8,11H,2-6H2,1H3/t7-,8+/m0/s1 |
| InChIKey | WWEASGPXQLNTSD-JGVFFNPUSA-N |
| XLogP | -0.56 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.28 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |