C15H31NO5SSi — CID 154680481
methyl (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(1,1-dioxo-1,4-thiazinan-4-yl)butanoate (PubChem CID 154680481) has the molecular formula C15H31NO5SSi and a molecular weight of 365.57 g/mol. Its IUPAC name is methyl (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(1,1-dioxo-1,4-thiazinan-4-yl)butanoate.
| Compound Name | methyl (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(1,1-dioxo-1,4-thiazinan-4-yl)butanoate |
|---|---|
| PubChem CID | 154680481 |
| Molecular Formula | C15H31NO5SSi |
| Molecular Weight | 365.57 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | methyl (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(1,1-dioxo-1,4-thiazinan-4-yl)butanoate |
| SMILES | COC(=O)[C@@H]([C@H](C)O[Si](C)(C)C(C)(C)C)N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C15H31NO5SSi/c1-12(21-23(6,7)15(2,3)4)13(14(17)20-5)16-8-10-22(18,19)11-9-16/h12-13H,8-11H2,1-7H3/t12-,13+/m0/s1 |
| InChIKey | LPKZYDRMTACRQW-QWHCGFSZSA-N |
| XLogP | 1.67 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.57 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|