About (2R)-1-[(6-chloro-3,5-difluoro-2-pyridinyl)methylamino]butan-2-ol
(2R)-1-[(6-chloro-3,5-difluoro-2-pyridinyl)methylamino]butan-2-ol (PubChem CID 154680545) has the molecular formula C10H13ClF2N2O
and a molecular weight of 250.68 g/mol. Its IUPAC name is (2R)-1-[(6-chloro-3,5-difluoro-2-pyridinyl)methylamino]butan-2-ol.
Molecular Properties
| Compound Name | (2R)-1-[(6-chloro-3,5-difluoro-2-pyridinyl)methylamino]butan-2-ol |
| PubChem CID | 154680545 |
| Molecular Formula | C10H13ClF2N2O |
| Molecular Weight | 250.68 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | (2R)-1-[(6-chloro-3,5-difluoro-2-pyridinyl)methylamino]butan-2-ol |
| SMILES | CC[C@@H](O)CNCc1nc(Cl)c(F)cc1F |
| InChI | InChI=1S/C10H13ClF2N2O/c1-2-6(16)4-14-5-9-7(12)3-8(13)10(11)15-9/h3,6,14,16H,2,4-5H2,1H3/t6-/m1/s1 |
| InChIKey | FJTGSJOZYXAGOL-ZCFIWIBFSA-N |
| XLogP | 1.87 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.68 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze (2R)-1-[(6-chloro-3,5-difluoro-2-pyridinyl)methylamino]butan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1-[(6-chloro-3,5-difluoro-2-pyridinyl)methylamino]butan-2-ol?
The IUPAC name of (2R)-1-[(6-chloro-3,5-difluoro-2-pyridinyl)methylamino]butan-2-ol (CID 154680545) is (2R)-1-[(6-chloro-3,5-difluoro-2-pyridinyl)methylamino]butan-2-ol.
What is the SMILES notation for (2R)-1-[(6-chloro-3,5-difluoro-2-pyridinyl)methylamino]butan-2-ol?
The canonical SMILES for (2R)-1-[(6-chloro-3,5-difluoro-2-pyridinyl)methylamino]butan-2-ol is CC[C@@H](O)CNCc1nc(Cl)c(F)cc1F.
What is the InChIKey of (2R)-1-[(6-chloro-3,5-difluoro-2-pyridinyl)methylamino]butan-2-ol?
The InChIKey is FJTGSJOZYXAGOL-ZCFIWIBFSA-N. The full InChI is InChI=1S/C10H13ClF2N2O/c1-2-6(16)4-14-5-9-7(12)3-8(13)10(11)15-9/h3,6,14,16H,2,4-5H2,1H3/t6-/m1/s1.
What are the key properties of (2R)-1-[(6-chloro-3,5-difluoro-2-pyridinyl)methylamino]butan-2-ol?
(2R)-1-[(6-chloro-3,5-difluoro-2-pyridinyl)methylamino]butan-2-ol has a molecular weight of 250.68 g/mol, XLogP of 1.87, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1-[(6-chloro-3,5-difluoro-2-pyridinyl)methylamino]butan-2-ol is sourced from PubChem (CID 154680545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).