C26H15ClN2O — CID 154680726
3-[6-chloro-2-(4-phenylphenyl)-1,3-benzoxazol-4-yl]benzonitrile (PubChem CID 154680726) has the molecular formula C26H15ClN2O and a molecular weight of 406.87 g/mol. Its IUPAC name is 3-[6-chloro-2-(4-phenylphenyl)-1,3-benzoxazol-4-yl]benzonitrile.
| Compound Name | 3-[6-chloro-2-(4-phenylphenyl)-1,3-benzoxazol-4-yl]benzonitrile |
|---|---|
| PubChem CID | 154680726 |
| Molecular Formula | C26H15ClN2O |
| Molecular Weight | 406.87 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | 3-[6-chloro-2-(4-phenylphenyl)-1,3-benzoxazol-4-yl]benzonitrile |
| SMILES | N#Cc1cccc(-c2cc(Cl)cc3oc(-c4ccc(-c5ccccc5)cc4)nc23)c1 |
| InChI | InChI=1S/C26H15ClN2O/c27-22-14-23(21-8-4-5-17(13-21)16-28)25-24(15-22)30-26(29-25)20-11-9-19(10-12-20)18-6-2-1-3-7-18/h1-15H |
| InChIKey | KCCWKVGQDNBMPK-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 49.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.87 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |