About 2,8-diazaspiro[4.5]decane-2-carboxamide;ethane;molecular hydrogen
2,8-diazaspiro[4.5]decane-2-carboxamide;ethane;molecular hydrogen (PubChem CID 154681036) has the molecular formula C11H25N3O
and a molecular weight of 215.34 g/mol. Its IUPAC name is 2,8-diazaspiro[4.5]decane-2-carboxamide;ethane;molecular hydrogen.
Molecular Properties
| Compound Name | 2,8-diazaspiro[4.5]decane-2-carboxamide;ethane;molecular hydrogen |
| PubChem CID | 154681036 |
| Molecular Formula | C11H25N3O |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.20 |
| IUPAC Name | 2,8-diazaspiro[4.5]decane-2-carboxamide;ethane;molecular hydrogen |
| SMILES | CC.NC(=O)N1CCC2(CCNCC2)C1.[H][H] |
| InChI | InChI=1S/C9H17N3O.C2H6.H2/c10-8(13)12-6-3-9(7-12)1-4-11-5-2-9;1-2;/h11H,1-7H2,(H2,10,13);1-2H3;1H |
| InChIKey | KPRXJDMAPQOXPG-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,8-diazaspiro[4.5]decane-2-carboxamide;ethane;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,8-diazaspiro[4.5]decane-2-carboxamide;ethane;molecular hydrogen?
The IUPAC name of 2,8-diazaspiro[4.5]decane-2-carboxamide;ethane;molecular hydrogen (CID 154681036) is 2,8-diazaspiro[4.5]decane-2-carboxamide;ethane;molecular hydrogen.
What is the SMILES notation for 2,8-diazaspiro[4.5]decane-2-carboxamide;ethane;molecular hydrogen?
The canonical SMILES for 2,8-diazaspiro[4.5]decane-2-carboxamide;ethane;molecular hydrogen is CC.NC(=O)N1CCC2(CCNCC2)C1.[H][H].
What is the InChIKey of 2,8-diazaspiro[4.5]decane-2-carboxamide;ethane;molecular hydrogen?
The InChIKey is KPRXJDMAPQOXPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3O.C2H6.H2/c10-8(13)12-6-3-9(7-12)1-4-11-5-2-9;1-2;/h11H,1-7H2,(H2,10,13);1-2H3;1H.
What are the key properties of 2,8-diazaspiro[4.5]decane-2-carboxamide;ethane;molecular hydrogen?
2,8-diazaspiro[4.5]decane-2-carboxamide;ethane;molecular hydrogen has a molecular weight of 215.34 g/mol, XLogP of 1.41, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,8-diazaspiro[4.5]decane-2-carboxamide;ethane;molecular hydrogen is sourced from PubChem (CID 154681036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).