About 11-oxapentacyclo[6.4.0.02,6.03,10.05,9]dodecane
11-oxapentacyclo[6.4.0.02,6.03,10.05,9]dodecane (PubChem CID 15468109) has the molecular formula C11H14O
and a molecular weight of 162.23 g/mol. Its IUPAC name is 11-oxapentacyclo[6.4.0.02,6.03,10.05,9]dodecane.
Molecular Properties
| Compound Name | 11-oxapentacyclo[6.4.0.02,6.03,10.05,9]dodecane |
| PubChem CID | 15468109 |
| Molecular Formula | C11H14O |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | 11-oxapentacyclo[6.4.0.02,6.03,10.05,9]dodecane |
| SMILES | C1OC2C3CC4C5CC(C1C53)C42 |
| InChI | InChI=1S/C11H14O/c1-4-5-2-7-9(4)8-3-12-11(7)10(5)6(1)8/h4-11H,1-3H2 |
| InChIKey | CAFYPVLDEXRMSF-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 11-oxapentacyclo[6.4.0.02,6.03,10.05,9]dodecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-oxapentacyclo[6.4.0.02,6.03,10.05,9]dodecane?
The IUPAC name of 11-oxapentacyclo[6.4.0.02,6.03,10.05,9]dodecane (CID 15468109) is 11-oxapentacyclo[6.4.0.02,6.03,10.05,9]dodecane.
What is the SMILES notation for 11-oxapentacyclo[6.4.0.02,6.03,10.05,9]dodecane?
The canonical SMILES for 11-oxapentacyclo[6.4.0.02,6.03,10.05,9]dodecane is C1OC2C3CC4C5CC(C1C53)C42.
What is the InChIKey of 11-oxapentacyclo[6.4.0.02,6.03,10.05,9]dodecane?
The InChIKey is CAFYPVLDEXRMSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O/c1-4-5-2-7-9(4)8-3-12-11(7)10(5)6(1)8/h4-11H,1-3H2.
What are the key properties of 11-oxapentacyclo[6.4.0.02,6.03,10.05,9]dodecane?
11-oxapentacyclo[6.4.0.02,6.03,10.05,9]dodecane has a molecular weight of 162.23 g/mol, XLogP of 1.53, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 11-oxapentacyclo[6.4.0.02,6.03,10.05,9]dodecane is sourced from PubChem (CID 15468109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).