C16H17ClN2O3S — CID 154681302
2-[5-chloro-7-(furan-2-ylmethylamino)-3-methylthieno[3,2-b]pyridin-2-yl]propane-1,2-diol (PubChem CID 154681302) has the molecular formula C16H17ClN2O3S and a molecular weight of 352.84 g/mol. Its IUPAC name is 2-[5-chloro-7-(furan-2-ylmethylamino)-3-methylthieno[3,2-b]pyridin-2-yl]propane-1,2-diol.
| Compound Name | 2-[5-chloro-7-(furan-2-ylmethylamino)-3-methylthieno[3,2-b]pyridin-2-yl]propane-1,2-diol |
|---|---|
| PubChem CID | 154681302 |
| Molecular Formula | C16H17ClN2O3S |
| Molecular Weight | 352.84 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | 2-[5-chloro-7-(furan-2-ylmethylamino)-3-methylthieno[3,2-b]pyridin-2-yl]propane-1,2-diol |
| SMILES | Cc1c(C(C)(O)CO)sc2c(NCc3ccco3)cc(Cl)nc12 |
| InChI | InChI=1S/C16H17ClN2O3S/c1-9-13-14(23-15(9)16(2,21)8-20)11(6-12(17)19-13)18-7-10-4-3-5-22-10/h3-6,20-21H,7-8H2,1-2H3,(H,18,19) |
| InChIKey | ZOVNOZUPXUIDTJ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.84 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|