About 1-[3-(2-bromo-4-tert-butylphenyl)-2-(methoxymethoxy)-5-methylphenyl]tricyclo[3.3.0.03,7]octane
1-[3-(2-bromo-4-tert-butylphenyl)-2-(methoxymethoxy)-5-methylphenyl]tricyclo[3.3.0.03,7]octane (PubChem CID 154681523) has the molecular formula C27H33BrO2
and a molecular weight of 469.46 g/mol. Its IUPAC name is 1-[3-(2-bromo-4-tert-butylphenyl)-2-(methoxymethoxy)-5-methylphenyl]tricyclo[3.3.0.03,7]octane.
Molecular Properties
| Compound Name | 1-[3-(2-bromo-4-tert-butylphenyl)-2-(methoxymethoxy)-5-methylphenyl]tricyclo[3.3.0.03,7]octane |
| PubChem CID | 154681523 |
| Molecular Formula | C27H33BrO2 |
| Molecular Weight | 469.46 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | 1-[3-(2-bromo-4-tert-butylphenyl)-2-(methoxymethoxy)-5-methylphenyl]tricyclo[3.3.0.03,7]octane |
| SMILES | COCOc1c(-c2ccc(C(C)(C)C)cc2Br)cc(C)cc1C12CC3CC1CC3C2 |
| InChI | InChI=1S/C27H33BrO2/c1-16-8-22(21-7-6-19(12-24(21)28)26(2,3)4)25(30-15-29-5)23(9-16)27-13-17-10-20(27)11-18(17)14-27/h6-9,12,17-18,20H,10-11,13-15H2,1-5H3 |
| InChIKey | ATPSIOICFGGWGZ-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 469.46 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-(2-bromo-4-tert-butylphenyl)-2-(methoxymethoxy)-5-methylphenyl]tricyclo[3.3.0.03,7]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(2-bromo-4-tert-butylphenyl)-2-(methoxymethoxy)-5-methylphenyl]tricyclo[3.3.0.03,7]octane?
The IUPAC name of 1-[3-(2-bromo-4-tert-butylphenyl)-2-(methoxymethoxy)-5-methylphenyl]tricyclo[3.3.0.03,7]octane (CID 154681523) is 1-[3-(2-bromo-4-tert-butylphenyl)-2-(methoxymethoxy)-5-methylphenyl]tricyclo[3.3.0.03,7]octane.
What is the SMILES notation for 1-[3-(2-bromo-4-tert-butylphenyl)-2-(methoxymethoxy)-5-methylphenyl]tricyclo[3.3.0.03,7]octane?
The canonical SMILES for 1-[3-(2-bromo-4-tert-butylphenyl)-2-(methoxymethoxy)-5-methylphenyl]tricyclo[3.3.0.03,7]octane is COCOc1c(-c2ccc(C(C)(C)C)cc2Br)cc(C)cc1C12CC3CC1CC3C2.
What is the InChIKey of 1-[3-(2-bromo-4-tert-butylphenyl)-2-(methoxymethoxy)-5-methylphenyl]tricyclo[3.3.0.03,7]octane?
The InChIKey is ATPSIOICFGGWGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H33BrO2/c1-16-8-22(21-7-6-19(12-24(21)28)26(2,3)4)25(30-15-29-5)23(9-16)27-13-17-10-20(27)11-18(17)14-27/h6-9,12,17-18,20H,10-11,13-15H2,1-5H3.
What are the key properties of 1-[3-(2-bromo-4-tert-butylphenyl)-2-(methoxymethoxy)-5-methylphenyl]tricyclo[3.3.0.03,7]octane?
1-[3-(2-bromo-4-tert-butylphenyl)-2-(methoxymethoxy)-5-methylphenyl]tricyclo[3.3.0.03,7]octane has a molecular weight of 469.46 g/mol, XLogP of 7.39, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(2-bromo-4-tert-butylphenyl)-2-(methoxymethoxy)-5-methylphenyl]tricyclo[3.3.0.03,7]octane is sourced from PubChem (CID 154681523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).