C9H9N3O2 — CID 154681840
1,4-dimethylpyrrolo[2,3-d]pyrazole-5,6-dicarbaldehyde (PubChem CID 154681840) has the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. Its IUPAC name is 1,4-dimethylpyrrolo[2,3-d]pyrazole-5,6-dicarbaldehyde.
| Compound Name | 1,4-dimethylpyrrolo[2,3-d]pyrazole-5,6-dicarbaldehyde |
|---|---|
| PubChem CID | 154681840 |
| Molecular Formula | C9H9N3O2 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | 1,4-dimethylpyrrolo[2,3-d]pyrazole-5,6-dicarbaldehyde |
| SMILES | Cn1ncc2c1c(C=O)c(C=O)n2C |
| InChI | InChI=1S/C9H9N3O2/c1-11-7-3-10-12(2)9(7)6(4-13)8(11)5-14/h3-5H,1-2H3 |
| InChIKey | BQDHDZLNZSOVGF-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 56.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|