About ethyl 2-[acetyloxy(5H-1,3-thiazol-5-id-2-yl)methyl]prop-2-enoate;rhenium
ethyl 2-[acetyloxy(5H-1,3-thiazol-5-id-2-yl)methyl]prop-2-enoate;rhenium (PubChem CID 154681884) has the molecular formula C11H12NO4ReS-
and a molecular weight of 440.49 g/mol. Its IUPAC name is ethyl 2-[acetyloxy(5H-1,3-thiazol-5-id-2-yl)methyl]prop-2-enoate;rhenium.
Molecular Properties
| Compound Name | ethyl 2-[acetyloxy(5H-1,3-thiazol-5-id-2-yl)methyl]prop-2-enoate;rhenium |
| PubChem CID | 154681884 |
| Molecular Formula | C11H12NO4ReS- |
| Molecular Weight | 440.49 g/mol |
| Exact Mass | 441.01 |
| IUPAC Name | ethyl 2-[acetyloxy(5H-1,3-thiazol-5-id-2-yl)methyl]prop-2-enoate;rhenium |
| SMILES | C=C(C(=O)OCC)C(OC(C)=O)c1nc[c-]s1.[Re] |
| InChI | InChI=1S/C11H12NO4S.Re/c1-4-15-11(14)7(2)9(16-8(3)13)10-12-5-6-17-10;/h5,9H,2,4H2,1,3H3;/q-1; |
| InChIKey | SISRWZMKMCGNAF-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.49 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[acetyloxy(5H-1,3-thiazol-5-id-2-yl)methyl]prop-2-enoate;rhenium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[acetyloxy(5H-1,3-thiazol-5-id-2-yl)methyl]prop-2-enoate;rhenium?
The IUPAC name of ethyl 2-[acetyloxy(5H-1,3-thiazol-5-id-2-yl)methyl]prop-2-enoate;rhenium (CID 154681884) is ethyl 2-[acetyloxy(5H-1,3-thiazol-5-id-2-yl)methyl]prop-2-enoate;rhenium.
What is the SMILES notation for ethyl 2-[acetyloxy(5H-1,3-thiazol-5-id-2-yl)methyl]prop-2-enoate;rhenium?
The canonical SMILES for ethyl 2-[acetyloxy(5H-1,3-thiazol-5-id-2-yl)methyl]prop-2-enoate;rhenium is C=C(C(=O)OCC)C(OC(C)=O)c1nc[c-]s1.[Re].
What is the InChIKey of ethyl 2-[acetyloxy(5H-1,3-thiazol-5-id-2-yl)methyl]prop-2-enoate;rhenium?
The InChIKey is SISRWZMKMCGNAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12NO4S.Re/c1-4-15-11(14)7(2)9(16-8(3)13)10-12-5-6-17-10;/h5,9H,2,4H2,1,3H3;/q-1;.
What are the key properties of ethyl 2-[acetyloxy(5H-1,3-thiazol-5-id-2-yl)methyl]prop-2-enoate;rhenium?
ethyl 2-[acetyloxy(5H-1,3-thiazol-5-id-2-yl)methyl]prop-2-enoate;rhenium has a molecular weight of 440.49 g/mol, XLogP of 1.66, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[acetyloxy(5H-1,3-thiazol-5-id-2-yl)methyl]prop-2-enoate;rhenium is sourced from PubChem (CID 154681884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).