About 3-[(3-acetylphenyl)methyl]-8-(benzenesulfonyl)-5-methylpyridazino[4,5-b]indol-4-one
3-[(3-acetylphenyl)methyl]-8-(benzenesulfonyl)-5-methylpyridazino[4,5-b]indol-4-one (PubChem CID 154681963) has the molecular formula C26H21N3O4S
and a molecular weight of 471.54 g/mol. Its IUPAC name is 3-[(3-acetylphenyl)methyl]-8-(benzenesulfonyl)-5-methylpyridazino[4,5-b]indol-4-one.
Molecular Properties
| Compound Name | 3-[(3-acetylphenyl)methyl]-8-(benzenesulfonyl)-5-methylpyridazino[4,5-b]indol-4-one |
| PubChem CID | 154681963 |
| Molecular Formula | C26H21N3O4S |
| Molecular Weight | 471.54 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | 3-[(3-acetylphenyl)methyl]-8-(benzenesulfonyl)-5-methylpyridazino[4,5-b]indol-4-one |
| SMILES | CC(=O)c1cccc(Cn2ncc3c4cc(S(=O)(=O)c5ccccc5)ccc4n(C)c3c2=O)c1 |
| InChI | InChI=1S/C26H21N3O4S/c1-17(30)19-8-6-7-18(13-19)16-29-26(31)25-23(15-27-29)22-14-21(11-12-24(22)28(25)2)34(32,33)20-9-4-3-5-10-20/h3-15H,16H2,1-2H3 |
| InChIKey | BYGVYADJZWBHNF-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 91.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 471.54 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-[(3-acetylphenyl)methyl]-8-(benzenesulfonyl)-5-methylpyridazino[4,5-b]indol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3-acetylphenyl)methyl]-8-(benzenesulfonyl)-5-methylpyridazino[4,5-b]indol-4-one?
The IUPAC name of 3-[(3-acetylphenyl)methyl]-8-(benzenesulfonyl)-5-methylpyridazino[4,5-b]indol-4-one (CID 154681963) is 3-[(3-acetylphenyl)methyl]-8-(benzenesulfonyl)-5-methylpyridazino[4,5-b]indol-4-one.
What is the SMILES notation for 3-[(3-acetylphenyl)methyl]-8-(benzenesulfonyl)-5-methylpyridazino[4,5-b]indol-4-one?
The canonical SMILES for 3-[(3-acetylphenyl)methyl]-8-(benzenesulfonyl)-5-methylpyridazino[4,5-b]indol-4-one is CC(=O)c1cccc(Cn2ncc3c4cc(S(=O)(=O)c5ccccc5)ccc4n(C)c3c2=O)c1.
What is the InChIKey of 3-[(3-acetylphenyl)methyl]-8-(benzenesulfonyl)-5-methylpyridazino[4,5-b]indol-4-one?
The InChIKey is BYGVYADJZWBHNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H21N3O4S/c1-17(30)19-8-6-7-18(13-19)16-29-26(31)25-23(15-27-29)22-14-21(11-12-24(22)28(25)2)34(32,33)20-9-4-3-5-10-20/h3-15H,16H2,1-2H3.
What are the key properties of 3-[(3-acetylphenyl)methyl]-8-(benzenesulfonyl)-5-methylpyridazino[4,5-b]indol-4-one?
3-[(3-acetylphenyl)methyl]-8-(benzenesulfonyl)-5-methylpyridazino[4,5-b]indol-4-one has a molecular weight of 471.54 g/mol, XLogP of 3.97, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3-acetylphenyl)methyl]-8-(benzenesulfonyl)-5-methylpyridazino[4,5-b]indol-4-one is sourced from PubChem (CID 154681963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).