About methyl 4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]bicyclo[2.2.2]octane-1-carboxylate
methyl 4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]bicyclo[2.2.2]octane-1-carboxylate (PubChem CID 154683175) has the molecular formula C13H15F3N2O3
and a molecular weight of 304.27 g/mol. Its IUPAC name is methyl 4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]bicyclo[2.2.2]octane-1-carboxylate.
Molecular Properties
| Compound Name | methyl 4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]bicyclo[2.2.2]octane-1-carboxylate |
| PubChem CID | 154683175 |
| Molecular Formula | C13H15F3N2O3 |
| Molecular Weight | 304.27 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | methyl 4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]bicyclo[2.2.2]octane-1-carboxylate |
| SMILES | COC(=O)C12CCC(c3noc(C(F)(F)F)n3)(CC1)CC2 |
| InChI | InChI=1S/C13H15F3N2O3/c1-20-10(19)12-5-2-11(3-6-12,4-7-12)8-17-9(21-18-8)13(14,15)16/h2-7H2,1H3 |
| InChIKey | RRPQFADOQIXRSG-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.27 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]bicyclo[2.2.2]octane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]bicyclo[2.2.2]octane-1-carboxylate?
The IUPAC name of methyl 4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]bicyclo[2.2.2]octane-1-carboxylate (CID 154683175) is methyl 4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]bicyclo[2.2.2]octane-1-carboxylate.
What is the SMILES notation for methyl 4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]bicyclo[2.2.2]octane-1-carboxylate?
The canonical SMILES for methyl 4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]bicyclo[2.2.2]octane-1-carboxylate is COC(=O)C12CCC(c3noc(C(F)(F)F)n3)(CC1)CC2.
What is the InChIKey of methyl 4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]bicyclo[2.2.2]octane-1-carboxylate?
The InChIKey is RRPQFADOQIXRSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15F3N2O3/c1-20-10(19)12-5-2-11(3-6-12,4-7-12)8-17-9(21-18-8)13(14,15)16/h2-7H2,1H3.
What are the key properties of methyl 4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]bicyclo[2.2.2]octane-1-carboxylate?
methyl 4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]bicyclo[2.2.2]octane-1-carboxylate has a molecular weight of 304.27 g/mol, XLogP of 2.85, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]bicyclo[2.2.2]octane-1-carboxylate is sourced from PubChem (CID 154683175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).