C15H20F2N2O — CID 154683306
4-[5-(1,1-difluoroethyl)-1-methylpyrazol-3-yl]bicyclo[2.2.2]octane-1-carbaldehyde (PubChem CID 154683306) has the molecular formula C15H20F2N2O and a molecular weight of 282.33 g/mol. Its IUPAC name is 4-[5-(1,1-difluoroethyl)-1-methylpyrazol-3-yl]bicyclo[2.2.2]octane-1-carbaldehyde.
| Compound Name | 4-[5-(1,1-difluoroethyl)-1-methylpyrazol-3-yl]bicyclo[2.2.2]octane-1-carbaldehyde |
|---|---|
| PubChem CID | 154683306 |
| Molecular Formula | C15H20F2N2O |
| Molecular Weight | 282.33 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 4-[5-(1,1-difluoroethyl)-1-methylpyrazol-3-yl]bicyclo[2.2.2]octane-1-carbaldehyde |
| SMILES | Cn1nc(C23CCC(C=O)(CC2)CC3)cc1C(C)(F)F |
| InChI | InChI=1S/C15H20F2N2O/c1-13(16,17)12-9-11(18-19(12)2)15-6-3-14(10-20,4-7-15)5-8-15/h9-10H,3-8H2,1-2H3 |
| InChIKey | SIBGKNDRVOTOGT-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.33 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|