C18H22N2O3 — CID 154683928
[1-(1-methylindazol-5-yl)-2-oxabicyclo[2.2.2]octan-4-yl]methyl acetate (PubChem CID 154683928) has the molecular formula C18H22N2O3 and a molecular weight of 314.39 g/mol. Its IUPAC name is [1-(1-methylindazol-5-yl)-2-oxabicyclo[2.2.2]octan-4-yl]methyl acetate.
| Compound Name | [1-(1-methylindazol-5-yl)-2-oxabicyclo[2.2.2]octan-4-yl]methyl acetate |
|---|---|
| PubChem CID | 154683928 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | [1-(1-methylindazol-5-yl)-2-oxabicyclo[2.2.2]octan-4-yl]methyl acetate |
| SMILES | CC(=O)OCC12CCC(c3ccc4c(cnn4C)c3)(CC1)OC2 |
| InChI | InChI=1S/C18H22N2O3/c1-13(21)22-11-17-5-7-18(8-6-17,23-12-17)15-3-4-16-14(9-15)10-19-20(16)2/h3-4,9-10H,5-8,11-12H2,1-2H3 |
| InChIKey | KUCROTOQEMKTLZ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |