C15H15N5 — CID 15468412
8-methyl-5-phenyl-4,5,7,9,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),2(6),3,7-tetraene (PubChem CID 15468412) has the molecular formula C15H15N5 and a molecular weight of 265.32 g/mol. Its IUPAC name is 8-methyl-5-phenyl-4,5,7,9,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),2(6),3,7-tetraene.
| Compound Name | 8-methyl-5-phenyl-4,5,7,9,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),2(6),3,7-tetraene |
|---|---|
| PubChem CID | 15468412 |
| Molecular Formula | C15H15N5 |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 8-methyl-5-phenyl-4,5,7,9,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),2(6),3,7-tetraene |
| SMILES | CC1=Nc2c(cnn2-c2ccccc2)C2=NCCCN12 |
| InChI | InChI=1S/C15H15N5/c1-11-18-15-13(14-16-8-5-9-19(11)14)10-17-20(15)12-6-3-2-4-7-12/h2-4,6-7,10H,5,8-9H2,1H3 |
| InChIKey | PTHXIOZEIUDDSJ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 45.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |