C17H20N2O4 — CID 154684223
4-(1,3-dioxo-5-propan-2-ylisoindol-2-yl)-N-formylpentanamide (PubChem CID 154684223) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is 4-(1,3-dioxo-5-propan-2-ylisoindol-2-yl)-N-formylpentanamide.
| Compound Name | 4-(1,3-dioxo-5-propan-2-ylisoindol-2-yl)-N-formylpentanamide |
|---|---|
| PubChem CID | 154684223 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 4-(1,3-dioxo-5-propan-2-ylisoindol-2-yl)-N-formylpentanamide |
| SMILES | CC(C)c1ccc2c(c1)C(=O)N(C(C)CCC(=O)NC=O)C2=O |
| InChI | InChI=1S/C17H20N2O4/c1-10(2)12-5-6-13-14(8-12)17(23)19(16(13)22)11(3)4-7-15(21)18-9-20/h5-6,8-11H,4,7H2,1-3H3,(H,18,20,21) |
| InChIKey | CWUIFTJFAUSZKT-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|