C12H24N2O — CID 154684414
2-(2-ethoxyethyl)-5-propan-2-yl-2,5-diazabicyclo[2.2.1]heptane (PubChem CID 154684414) has the molecular formula C12H24N2O and a molecular weight of 212.34 g/mol. Its IUPAC name is 2-(2-ethoxyethyl)-5-propan-2-yl-2,5-diazabicyclo[2.2.1]heptane.
| Compound Name | 2-(2-ethoxyethyl)-5-propan-2-yl-2,5-diazabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 154684414 |
| Molecular Formula | C12H24N2O |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | 2-(2-ethoxyethyl)-5-propan-2-yl-2,5-diazabicyclo[2.2.1]heptane |
| SMILES | CCOCCN1CC2CC1CN2C(C)C |
| InChI | InChI=1S/C12H24N2O/c1-4-15-6-5-13-8-12-7-11(13)9-14(12)10(2)3/h10-12H,4-9H2,1-3H3 |
| InChIKey | GYRJDHCNUPANGE-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|