C26H22Cl2N6O6 — CID 154684614
6-[2-(2,6-dichloro-3,5-dimethoxyanilino)-3-pyridinyl]-N-[2-nitro-4-(oxetan-3-yloxy)phenyl]pyrimidin-4-amine (PubChem CID 154684614) has the molecular formula C26H22Cl2N6O6 and a molecular weight of 585.40 g/mol. Its IUPAC name is 6-[2-(2,6-dichloro-3,5-dimethoxyanilino)-3-pyridinyl]-N-[2-nitro-4-(oxetan-3-yloxy)phenyl]pyrimidin-4-amine.
| Compound Name | 6-[2-(2,6-dichloro-3,5-dimethoxyanilino)-3-pyridinyl]-N-[2-nitro-4-(oxetan-3-yloxy)phenyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 154684614 |
| Molecular Formula | C26H22Cl2N6O6 |
| Molecular Weight | 585.40 g/mol |
| Exact Mass | 584.10 |
| IUPAC Name | 6-[2-(2,6-dichloro-3,5-dimethoxyanilino)-3-pyridinyl]-N-[2-nitro-4-(oxetan-3-yloxy)phenyl]pyrimidin-4-amine |
| SMILES | COc1cc(OC)c(Cl)c(Nc2ncccc2-c2cc(Nc3ccc(OC4COC4)cc3[N+](=O)[O-])ncn2)c1Cl |
| InChI | InChI=1S/C26H22Cl2N6O6/c1-37-20-10-21(38-2)24(28)25(23(20)27)33-26-16(4-3-7-29-26)18-9-22(31-13-30-18)32-17-6-5-14(8-19(17)34(35)36)40-15-11-39-12-15/h3-10,13,15H,11-12H2,1-2H3,(H,29,33)(H,30,31,32) |
| InChIKey | HQNRZFKJGWTPCX-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 142.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.40 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|