C24H28N2O4 — CID 154685147
9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-[(2E)-2-hydroxyiminopropanoyl]-3-azaspiro[5.5]undecane-8,10-dione (PubChem CID 154685147) has the molecular formula C24H28N2O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is 9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-[(2E)-2-hydroxyiminopropanoyl]-3-azaspiro[5.5]undecane-8,10-dione.
| Compound Name | 9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-[(2E)-2-hydroxyiminopropanoyl]-3-azaspiro[5.5]undecane-8,10-dione |
|---|---|
| PubChem CID | 154685147 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-[(2E)-2-hydroxyiminopropanoyl]-3-azaspiro[5.5]undecane-8,10-dione |
| SMILES | CC#Cc1cc(C)c(C2C(=O)CC3(CCN(C(=O)/C(C)=N/O)CC3)CC2=O)c(C)c1 |
| InChI | InChI=1S/C24H28N2O4/c1-5-6-18-11-15(2)21(16(3)12-18)22-19(27)13-24(14-20(22)28)7-9-26(10-8-24)23(29)17(4)25-30/h11-12,22,30H,7-10,13-14H2,1-4H3/b25-17+ |
| InChIKey | NOUWUDNZCJLCJW-KOEQRZSOSA-N |
| XLogP | 3.15 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|