C25H27N3O4 — CID 154685149
2-[(E)-[2-[9-(2,6-dimethyl-4-prop-1-ynylphenyl)-8,10-dioxo-3-azaspiro[5.5]undecan-3-yl]-2-oxoethylidene]amino]oxyacetonitrile (PubChem CID 154685149) has the molecular formula C25H27N3O4 and a molecular weight of 433.51 g/mol. Its IUPAC name is 2-[(E)-[2-[9-(2,6-dimethyl-4-prop-1-ynylphenyl)-8,10-dioxo-3-azaspiro[5.5]undecan-3-yl]-2-oxoethylidene]amino]oxyacetonitrile.
| Compound Name | 2-[(E)-[2-[9-(2,6-dimethyl-4-prop-1-ynylphenyl)-8,10-dioxo-3-azaspiro[5.5]undecan-3-yl]-2-oxoethylidene]amino]oxyacetonitrile |
|---|---|
| PubChem CID | 154685149 |
| Molecular Formula | C25H27N3O4 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | 2-[(E)-[2-[9-(2,6-dimethyl-4-prop-1-ynylphenyl)-8,10-dioxo-3-azaspiro[5.5]undecan-3-yl]-2-oxoethylidene]amino]oxyacetonitrile |
| SMILES | CC#Cc1cc(C)c(C2C(=O)CC3(CCN(C(=O)/C=N/OCC#N)CC3)CC2=O)c(C)c1 |
| InChI | InChI=1S/C25H27N3O4/c1-4-5-19-12-17(2)23(18(3)13-19)24-20(29)14-25(15-21(24)30)6-9-28(10-7-25)22(31)16-27-32-11-8-26/h12-13,16,24H,6-7,9-11,14-15H2,1-3H3/b27-16+ |
| InChIKey | IJRYQNFTAMPIGM-JVWAILMASA-N |
| XLogP | 2.83 |
| TPSA | 99.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|