About tert-butyl N-(1,1-difluoro-3-hydroxy-2-methylpropan-2-yl)carbamate
tert-butyl N-(1,1-difluoro-3-hydroxy-2-methylpropan-2-yl)carbamate (PubChem CID 154685497) has the molecular formula C9H17F2NO3
and a molecular weight of 225.23 g/mol. Its IUPAC name is tert-butyl N-(1,1-difluoro-3-hydroxy-2-methylpropan-2-yl)carbamate.
Molecular Properties
| Compound Name | tert-butyl N-(1,1-difluoro-3-hydroxy-2-methylpropan-2-yl)carbamate |
| PubChem CID | 154685497 |
| Molecular Formula | C9H17F2NO3 |
| Molecular Weight | 225.23 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | tert-butyl N-(1,1-difluoro-3-hydroxy-2-methylpropan-2-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)NC(C)(CO)C(F)F |
| InChI | InChI=1S/C9H17F2NO3/c1-8(2,3)15-7(14)12-9(4,5-13)6(10)11/h6,13H,5H2,1-4H3,(H,12,14) |
| InChIKey | LXKRBFVWQUHXFO-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.23 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl N-(1,1-difluoro-3-hydroxy-2-methylpropan-2-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-(1,1-difluoro-3-hydroxy-2-methylpropan-2-yl)carbamate?
The IUPAC name of tert-butyl N-(1,1-difluoro-3-hydroxy-2-methylpropan-2-yl)carbamate (CID 154685497) is tert-butyl N-(1,1-difluoro-3-hydroxy-2-methylpropan-2-yl)carbamate.
What is the SMILES notation for tert-butyl N-(1,1-difluoro-3-hydroxy-2-methylpropan-2-yl)carbamate?
The canonical SMILES for tert-butyl N-(1,1-difluoro-3-hydroxy-2-methylpropan-2-yl)carbamate is CC(C)(C)OC(=O)NC(C)(CO)C(F)F.
What is the InChIKey of tert-butyl N-(1,1-difluoro-3-hydroxy-2-methylpropan-2-yl)carbamate?
The InChIKey is LXKRBFVWQUHXFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17F2NO3/c1-8(2,3)15-7(14)12-9(4,5-13)6(10)11/h6,13H,5H2,1-4H3,(H,12,14).
What are the key properties of tert-butyl N-(1,1-difluoro-3-hydroxy-2-methylpropan-2-yl)carbamate?
tert-butyl N-(1,1-difluoro-3-hydroxy-2-methylpropan-2-yl)carbamate has a molecular weight of 225.23 g/mol, XLogP of 1.53, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-(1,1-difluoro-3-hydroxy-2-methylpropan-2-yl)carbamate is sourced from PubChem (CID 154685497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).