C8H10N2O2S — CID 15468567
N-ethyl-N-(6-oxo-1,3-thiazin-2-yl)acetamide (PubChem CID 15468567) has the molecular formula C8H10N2O2S and a molecular weight of 198.25 g/mol. Its IUPAC name is N-ethyl-N-(6-oxo-1,3-thiazin-2-yl)acetamide.
| Compound Name | N-ethyl-N-(6-oxo-1,3-thiazin-2-yl)acetamide |
|---|---|
| PubChem CID | 15468567 |
| Molecular Formula | C8H10N2O2S |
| Molecular Weight | 198.25 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | N-ethyl-N-(6-oxo-1,3-thiazin-2-yl)acetamide |
| SMILES | CCN(C(C)=O)c1nccc(=O)s1 |
| InChI | InChI=1S/C8H10N2O2S/c1-3-10(6(2)11)8-9-5-4-7(12)13-8/h4-5H,3H2,1-2H3 |
| InChIKey | DBBLDXMLUADQHQ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.25 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |