C14H14FN3 — CID 154686329
6-[(3E)-5-fluoro-4-methylhexa-1,3,5-trien-3-yl]imidazo[1,2-a]pyridin-2-amine (PubChem CID 154686329) has the molecular formula C14H14FN3 and a molecular weight of 243.28 g/mol. Its IUPAC name is 6-[(3E)-5-fluoro-4-methylhexa-1,3,5-trien-3-yl]imidazo[1,2-a]pyridin-2-amine.
| Compound Name | 6-[(3E)-5-fluoro-4-methylhexa-1,3,5-trien-3-yl]imidazo[1,2-a]pyridin-2-amine |
|---|---|
| PubChem CID | 154686329 |
| Molecular Formula | C14H14FN3 |
| Molecular Weight | 243.28 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | 6-[(3E)-5-fluoro-4-methylhexa-1,3,5-trien-3-yl]imidazo[1,2-a]pyridin-2-amine |
| SMILES | C=C/C(=C(/C)C(=C)F)c1ccc2nc(N)cn2c1 |
| InChI | InChI=1S/C14H14FN3/c1-4-12(9(2)10(3)15)11-5-6-14-17-13(16)8-18(14)7-11/h4-8H,1,3,16H2,2H3/b12-9+ |
| InChIKey | PJNPZOZDWFLVOS-FMIVXFBMSA-N |
| XLogP | 3.36 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.28 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|