C16H16F3NO4 — CID 154686568
ethyl 4-methyl-5-oxo-1-(2,2,2-trifluoroacetyl)-2,3-dihydro-1-benzazepine-4-carboxylate (PubChem CID 154686568) has the molecular formula C16H16F3NO4 and a molecular weight of 343.30 g/mol. Its IUPAC name is ethyl 4-methyl-5-oxo-1-(2,2,2-trifluoroacetyl)-2,3-dihydro-1-benzazepine-4-carboxylate.
| Compound Name | ethyl 4-methyl-5-oxo-1-(2,2,2-trifluoroacetyl)-2,3-dihydro-1-benzazepine-4-carboxylate |
|---|---|
| PubChem CID | 154686568 |
| Molecular Formula | C16H16F3NO4 |
| Molecular Weight | 343.30 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | ethyl 4-methyl-5-oxo-1-(2,2,2-trifluoroacetyl)-2,3-dihydro-1-benzazepine-4-carboxylate |
| SMILES | CCOC(=O)C1(C)CCN(C(=O)C(F)(F)F)c2ccccc2C1=O |
| InChI | InChI=1S/C16H16F3NO4/c1-3-24-14(23)15(2)8-9-20(13(22)16(17,18)19)11-7-5-4-6-10(11)12(15)21/h4-7H,3,8-9H2,1-2H3 |
| InChIKey | VFQJSZDPSYDVLZ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.30 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|