C29H39N5O2Si — CID 154686648
6-[4-[2-ethyl-1-(1,2,4-triazol-1-yl)butyl]anilino]-1-(2-trimethylsilylethoxymethyl)quinolin-2-one (PubChem CID 154686648) has the molecular formula C29H39N5O2Si and a molecular weight of 517.75 g/mol. Its IUPAC name is 6-[4-[2-ethyl-1-(1,2,4-triazol-1-yl)butyl]anilino]-1-(2-trimethylsilylethoxymethyl)quinolin-2-one.
| Compound Name | 6-[4-[2-ethyl-1-(1,2,4-triazol-1-yl)butyl]anilino]-1-(2-trimethylsilylethoxymethyl)quinolin-2-one |
|---|---|
| PubChem CID | 154686648 |
| Molecular Formula | C29H39N5O2Si |
| Molecular Weight | 517.75 g/mol |
| Exact Mass | 517.29 |
| IUPAC Name | 6-[4-[2-ethyl-1-(1,2,4-triazol-1-yl)butyl]anilino]-1-(2-trimethylsilylethoxymethyl)quinolin-2-one |
| SMILES | CCC(CC)C(c1ccc(Nc2ccc3c(ccc(=O)n3COCC[Si](C)(C)C)c2)cc1)n1cncn1 |
| InChI | InChI=1S/C29H39N5O2Si/c1-6-22(7-2)29(34-20-30-19-31-34)23-8-11-25(12-9-23)32-26-13-14-27-24(18-26)10-15-28(35)33(27)21-36-16-17-37(3,4)5/h8-15,18-20,22,29,32H,6-7,16-17,21H2,1-5H3 |
| InChIKey | TUCFEJMGNSRGAM-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 73.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.75 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|